C18H17N3O4S2 — CID 4801245
4-[(2-methoxyphenyl)-methylsulfamoyl]-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 4801245) has the molecular formula C18H17N3O4S2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 4-[(2-methoxyphenyl)-methylsulfamoyl]-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 4-[(2-methoxyphenyl)-methylsulfamoyl]-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 4801245 |
| Molecular Formula | C18H17N3O4S2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 4-[(2-methoxyphenyl)-methylsulfamoyl]-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | COc1ccccc1N(C)S(=O)(=O)c1ccc(C(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C18H17N3O4S2/c1-21(15-5-3-4-6-16(15)25-2)27(23,24)14-9-7-13(8-10-14)17(22)20-18-19-11-12-26-18/h3-12H,1-2H3,(H,19,20,22) |
| InChIKey | AKGWDQYIRXDMJZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |