C22H23N3O3S — CID 4807360
[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-quinolin-2-ylmethanone (PubChem CID 4807360) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is [4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-quinolin-2-ylmethanone.
| Compound Name | [4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-quinolin-2-ylmethanone |
|---|---|
| PubChem CID | 4807360 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-quinolin-2-ylmethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)c3ccc4ccccc4n3)CC2)c(C)c1 |
| InChI | InChI=1S/C22H23N3O3S/c1-16-7-10-21(17(2)15-16)29(27,28)25-13-11-24(12-14-25)22(26)20-9-8-18-5-3-4-6-19(18)23-20/h3-10,15H,11-14H2,1-2H3 |
| InChIKey | CASHBVRWVAXPMX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |