C17H15NO2 — CID 4816204
(4-cyanophenyl) 2-(3,4-dimethylphenyl)acetate (PubChem CID 4816204) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is (4-cyanophenyl) 2-(3,4-dimethylphenyl)acetate.
| Compound Name | (4-cyanophenyl) 2-(3,4-dimethylphenyl)acetate |
|---|---|
| PubChem CID | 4816204 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (4-cyanophenyl) 2-(3,4-dimethylphenyl)acetate |
| SMILES | Cc1ccc(CC(=O)Oc2ccc(C#N)cc2)cc1C |
| InChI | InChI=1S/C17H15NO2/c1-12-3-4-15(9-13(12)2)10-17(19)20-16-7-5-14(11-18)6-8-16/h3-9H,10H2,1-2H3 |
| InChIKey | QSCDMLHDZZUMDK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|