C19H19NO3 — CID 8799809
(4-cyano-2-ethoxyphenyl) 2-(3,4-dimethylphenyl)acetate (PubChem CID 8799809) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is (4-cyano-2-ethoxyphenyl) 2-(3,4-dimethylphenyl)acetate.
| Compound Name | (4-cyano-2-ethoxyphenyl) 2-(3,4-dimethylphenyl)acetate |
|---|---|
| PubChem CID | 8799809 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (4-cyano-2-ethoxyphenyl) 2-(3,4-dimethylphenyl)acetate |
| SMILES | CCOc1cc(C#N)ccc1OC(=O)Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H19NO3/c1-4-22-18-10-16(12-20)7-8-17(18)23-19(21)11-15-6-5-13(2)14(3)9-15/h5-10H,4,11H2,1-3H3 |
| InChIKey | AZPUKVUWUCHDCO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|