About (4-cyano-2-ethoxyphenyl) 5-bromo-3-methylfuran-2-carboxylate
(4-cyano-2-ethoxyphenyl) 5-bromo-3-methylfuran-2-carboxylate (PubChem CID 55774223) has the molecular formula C15H12BrNO4
and a molecular weight of 350.17 g/mol. Its IUPAC name is (4-cyano-2-ethoxyphenyl) 5-bromo-3-methylfuran-2-carboxylate.
Molecular Properties
| Compound Name | (4-cyano-2-ethoxyphenyl) 5-bromo-3-methylfuran-2-carboxylate |
| PubChem CID | 55774223 |
| Molecular Formula | C15H12BrNO4 |
| Molecular Weight | 350.17 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | (4-cyano-2-ethoxyphenyl) 5-bromo-3-methylfuran-2-carboxylate |
| SMILES | CCOc1cc(C#N)ccc1OC(=O)c1oc(Br)cc1C |
| InChI | InChI=1S/C15H12BrNO4/c1-3-19-12-7-10(8-17)4-5-11(12)20-15(18)14-9(2)6-13(16)21-14/h4-7H,3H2,1-2H3 |
| InChIKey | ZTCLQVNRIZGKMT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 72.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.17 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-cyano-2-ethoxyphenyl) 5-bromo-3-methylfuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyano-2-ethoxyphenyl) 5-bromo-3-methylfuran-2-carboxylate?
The IUPAC name of (4-cyano-2-ethoxyphenyl) 5-bromo-3-methylfuran-2-carboxylate (CID 55774223) is (4-cyano-2-ethoxyphenyl) 5-bromo-3-methylfuran-2-carboxylate.
What is the SMILES notation for (4-cyano-2-ethoxyphenyl) 5-bromo-3-methylfuran-2-carboxylate?
The canonical SMILES for (4-cyano-2-ethoxyphenyl) 5-bromo-3-methylfuran-2-carboxylate is CCOc1cc(C#N)ccc1OC(=O)c1oc(Br)cc1C.
What is the InChIKey of (4-cyano-2-ethoxyphenyl) 5-bromo-3-methylfuran-2-carboxylate?
The InChIKey is ZTCLQVNRIZGKMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrNO4/c1-3-19-12-7-10(8-17)4-5-11(12)20-15(18)14-9(2)6-13(16)21-14/h4-7H,3H2,1-2H3.
What are the key properties of (4-cyano-2-ethoxyphenyl) 5-bromo-3-methylfuran-2-carboxylate?
(4-cyano-2-ethoxyphenyl) 5-bromo-3-methylfuran-2-carboxylate has a molecular weight of 350.17 g/mol, XLogP of 3.84, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyano-2-ethoxyphenyl) 5-bromo-3-methylfuran-2-carboxylate is sourced from PubChem (CID 55774223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).