C17H13Cl2NO3 — CID 8800013
(4-cyano-2-ethoxyphenyl) 2-(2,6-dichlorophenyl)acetate (PubChem CID 8800013) has the molecular formula C17H13Cl2NO3 and a molecular weight of 350.20 g/mol. Its IUPAC name is (4-cyano-2-ethoxyphenyl) 2-(2,6-dichlorophenyl)acetate.
| Compound Name | (4-cyano-2-ethoxyphenyl) 2-(2,6-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 8800013 |
| Molecular Formula | C17H13Cl2NO3 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | (4-cyano-2-ethoxyphenyl) 2-(2,6-dichlorophenyl)acetate |
| SMILES | CCOc1cc(C#N)ccc1OC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H13Cl2NO3/c1-2-22-16-8-11(10-20)6-7-15(16)23-17(21)9-12-13(18)4-3-5-14(12)19/h3-8H,2,9H2,1H3 |
| InChIKey | IGSHFVHSNCIFLZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|