C23H25N3O4S — CID 4817228
ethyl 2,4-dimethyl-5-[2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanoyl]-1H-pyrrole-3-carboxylate (PubChem CID 4817228) has the molecular formula C23H25N3O4S and a molecular weight of 439.54 g/mol. Its IUPAC name is ethyl 2,4-dimethyl-5-[2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanoyl]-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2,4-dimethyl-5-[2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanoyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 4817228 |
| Molecular Formula | C23H25N3O4S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | ethyl 2,4-dimethyl-5-[2-(4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanoyl]-1H-pyrrole-3-carboxylate |
| SMILES | C=CCn1c(SC(C)C(=O)c2[nH]c(C)c(C(=O)OCC)c2C)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H25N3O4S/c1-6-12-26-21(28)16-10-8-9-11-17(16)25-23(26)31-15(5)20(27)19-13(3)18(14(4)24-19)22(29)30-7-2/h6,8-11,15,24H,1,7,12H2,2-5H3 |
| InChIKey | XVRKAFMWRUSAMD-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|