C15H17N3O3S2 — CID 4822129
1-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide (PubChem CID 4822129) has the molecular formula C15H17N3O3S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide.
| Compound Name | 1-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 4822129 |
| Molecular Formula | C15H17N3O3S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 1-(benzenesulfonyl)-N-(1,3-thiazol-2-yl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1nccs1)C1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C15H17N3O3S2/c19-14(17-15-16-8-11-22-15)12-6-9-18(10-7-12)23(20,21)13-4-2-1-3-5-13/h1-5,8,11-12H,6-7,9-10H2,(H,16,17,19) |
| InChIKey | VMYUVLKUOMLFJP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |