C27H20N2O2S — CID 4829307
3-(2,4-dimethoxyphenyl)-2-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 4829307) has the molecular formula C27H20N2O2S and a molecular weight of 436.54 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-2-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | 3-(2,4-dimethoxyphenyl)-2-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4829307 |
| Molecular Formula | C27H20N2O2S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-2-[4-(9H-fluoren-2-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | COc1ccc(C=C(C#N)c2nc(-c3ccc4c(c3)Cc3ccccc3-4)cs2)c(OC)c1 |
| InChI | InChI=1S/C27H20N2O2S/c1-30-22-9-7-19(26(14-22)31-2)13-21(15-28)27-29-25(16-32-27)18-8-10-24-20(12-18)11-17-5-3-4-6-23(17)24/h3-10,12-14,16H,11H2,1-2H3 |
| InChIKey | OYEVGEKTUKAJGF-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|