C18H24BrN3O2S2 — CID 4830137
N-[2-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]ethyl]-4-methylbenzenesulfonamide (PubChem CID 4830137) has the molecular formula C18H24BrN3O2S2 and a molecular weight of 458.45 g/mol. Its IUPAC name is N-[2-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 4830137 |
| Molecular Formula | C18H24BrN3O2S2 |
| Molecular Weight | 458.45 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | N-[2-[4-[(5-bromothiophen-2-yl)methyl]piperazin-1-yl]ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCN2CCN(Cc3ccc(Br)s3)CC2)cc1 |
| InChI | InChI=1S/C18H24BrN3O2S2/c1-15-2-5-17(6-3-15)26(23,24)20-8-9-21-10-12-22(13-11-21)14-16-4-7-18(19)25-16/h2-7,20H,8-14H2,1H3 |
| InChIKey | OPFXYOUYMGDUDG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |