C29H32N2O6S — CID 4831398
[2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 3-(3-methoxyphenyl)-2-phenylprop-2-enoate (PubChem CID 4831398) has the molecular formula C29H32N2O6S and a molecular weight of 536.65 g/mol. Its IUPAC name is [2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 3-(3-methoxyphenyl)-2-phenylprop-2-enoate.
| Compound Name | [2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 3-(3-methoxyphenyl)-2-phenylprop-2-enoate |
|---|---|
| PubChem CID | 4831398 |
| Molecular Formula | C29H32N2O6S |
| Molecular Weight | 536.65 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | [2-[3-(diethylsulfamoyl)-4-methylanilino]-2-oxoethyl] 3-(3-methoxyphenyl)-2-phenylprop-2-enoate |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)COC(=O)C(=Cc2cccc(OC)c2)c2ccccc2)ccc1C |
| InChI | InChI=1S/C29H32N2O6S/c1-5-31(6-2)38(34,35)27-19-24(16-15-21(27)3)30-28(32)20-37-29(33)26(23-12-8-7-9-13-23)18-22-11-10-14-25(17-22)36-4/h7-19H,5-6,20H2,1-4H3,(H,30,32) |
| InChIKey | XRZPTKAZPSNPHU-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.65 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|