C25H29NO8 — CID 4838810
N-[8-hydroxy-2-(2-methoxyphenyl)-6-(2-propanoylphenoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide (PubChem CID 4838810) has the molecular formula C25H29NO8 and a molecular weight of 471.51 g/mol. Its IUPAC name is N-[8-hydroxy-2-(2-methoxyphenyl)-6-(2-propanoylphenoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide.
| Compound Name | N-[8-hydroxy-2-(2-methoxyphenyl)-6-(2-propanoylphenoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
|---|---|
| PubChem CID | 4838810 |
| Molecular Formula | C25H29NO8 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | N-[8-hydroxy-2-(2-methoxyphenyl)-6-(2-propanoylphenoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
| SMILES | CCC(=O)c1ccccc1OC1OC2COC(c3ccccc3OC)OC2C(O)C1NC(C)=O |
| InChI | InChI=1S/C25H29NO8/c1-4-17(28)15-9-5-8-12-19(15)32-25-21(26-14(2)27)22(29)23-20(33-25)13-31-24(34-23)16-10-6-7-11-18(16)30-3/h5-12,20-25,29H,4,13H2,1-3H3,(H,26,27) |
| InChIKey | XWIGFKZLAOFXOL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |