C22H22ClN3O2S — CID 4840478
N-(2-chlorophenyl)-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-6-sulfonamide (PubChem CID 4840478) has the molecular formula C22H22ClN3O2S and a molecular weight of 427.96 g/mol. Its IUPAC name is N-(2-chlorophenyl)-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-6-sulfonamide.
| Compound Name | N-(2-chlorophenyl)-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-6-sulfonamide |
|---|---|
| PubChem CID | 4840478 |
| Molecular Formula | C22H22ClN3O2S |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | N-(2-chlorophenyl)-12,15,15-trimethyl-3,10-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-2,4(9),5,7,10-pentaene-6-sulfonamide |
| SMILES | CC12CCC(c3nc4cc(S(=O)(=O)Nc5ccccc5Cl)ccc4nc31)C2(C)C |
| InChI | InChI=1S/C22H22ClN3O2S/c1-21(2)14-10-11-22(21,3)20-19(14)24-18-12-13(8-9-17(18)25-20)29(27,28)26-16-7-5-4-6-15(16)23/h4-9,12,14,26H,10-11H2,1-3H3 |
| InChIKey | KTFVKGCMVQQZTP-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |