C24H29N3O3S — CID 4840684
N-[4-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-3-(1H-indol-3-yl)propanamide (PubChem CID 4840684) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-[4-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-3-(1H-indol-3-yl)propanamide.
| Compound Name | N-[4-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-3-(1H-indol-3-yl)propanamide |
|---|---|
| PubChem CID | 4840684 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[4-(3,5-dimethylpiperidin-1-yl)sulfonylphenyl]-3-(1H-indol-3-yl)propanamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(NC(=O)CCc3c[nH]c4ccccc34)cc2)C1 |
| InChI | InChI=1S/C24H29N3O3S/c1-17-13-18(2)16-27(15-17)31(29,30)21-10-8-20(9-11-21)26-24(28)12-7-19-14-25-23-6-4-3-5-22(19)23/h3-6,8-11,14,17-18,25H,7,12-13,15-16H2,1-2H3,(H,26,28) |
| InChIKey | WPZIIKYQQOXSIP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |