C14H18N6O3S2 — CID 4841258
2-(1-methyltetrazol-5-yl)sulfanyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide (PubChem CID 4841258) has the molecular formula C14H18N6O3S2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 2-(1-methyltetrazol-5-yl)sulfanyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 4841258 |
| Molecular Formula | C14H18N6O3S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 2-(1-methyltetrazol-5-yl)sulfanyl-N-(3-pyrrolidin-1-ylsulfonylphenyl)acetamide |
| SMILES | Cn1nnnc1SCC(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C14H18N6O3S2/c1-19-14(16-17-18-19)24-10-13(21)15-11-5-4-6-12(9-11)25(22,23)20-7-2-3-8-20/h4-6,9H,2-3,7-8,10H2,1H3,(H,15,21) |
| InChIKey | SAULGNSCZMOFHZ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |