C18H30N8O3S — CID 4841991
N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)-4-(1-methyltetrazol-5-yl)sulfanylbutanamide (PubChem CID 4841991) has the molecular formula C18H30N8O3S and a molecular weight of 438.56 g/mol. Its IUPAC name is N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)-4-(1-methyltetrazol-5-yl)sulfanylbutanamide.
| Compound Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)-4-(1-methyltetrazol-5-yl)sulfanylbutanamide |
|---|---|
| PubChem CID | 4841991 |
| Molecular Formula | C18H30N8O3S |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | N-(6-amino-1-butyl-2,4-dioxopyrimidin-5-yl)-N-(2-methylpropyl)-4-(1-methyltetrazol-5-yl)sulfanylbutanamide |
| SMILES | CCCCn1c(N)c(N(CC(C)C)C(=O)CCCSc2nnnn2C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H30N8O3S/c1-5-6-9-25-15(19)14(16(28)20-17(25)29)26(11-12(2)3)13(27)8-7-10-30-18-21-22-23-24(18)4/h12H,5-11,19H2,1-4H3,(H,20,28,29) |
| InChIKey | MILDJALEVIQRMK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 144.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|