C19H19ClF3N3O2 — CID 4843275
2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-(4-piperidin-1-ylphenyl)acetamide (PubChem CID 4843275) has the molecular formula C19H19ClF3N3O2 and a molecular weight of 413.83 g/mol. Its IUPAC name is 2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-(4-piperidin-1-ylphenyl)acetamide.
| Compound Name | 2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-(4-piperidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 4843275 |
| Molecular Formula | C19H19ClF3N3O2 |
| Molecular Weight | 413.83 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 2-[3-chloro-2-oxo-5-(trifluoromethyl)-1-pyridinyl]-N-(4-piperidin-1-ylphenyl)acetamide |
| SMILES | O=C(Cn1cc(C(F)(F)F)cc(Cl)c1=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H19ClF3N3O2/c20-16-10-13(19(21,22)23)11-26(18(16)28)12-17(27)24-14-4-6-15(7-5-14)25-8-2-1-3-9-25/h4-7,10-11H,1-3,8-9,12H2,(H,24,27) |
| InChIKey | COJPAUKTMQCCLC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.83 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|