C21H18N4O — CID 4843986
2-(2,6-dimethylanilino)-N-(naphthalen-2-ylamino)-2-oxoethanimidoyl cyanide (PubChem CID 4843986) has the molecular formula C21H18N4O and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-(2,6-dimethylanilino)-N-(naphthalen-2-ylamino)-2-oxoethanimidoyl cyanide.
| Compound Name | 2-(2,6-dimethylanilino)-N-(naphthalen-2-ylamino)-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 4843986 |
| Molecular Formula | C21H18N4O |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-(2,6-dimethylanilino)-N-(naphthalen-2-ylamino)-2-oxoethanimidoyl cyanide |
| SMILES | Cc1cccc(C)c1NC(=O)C(C#N)=NNc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H18N4O/c1-14-6-5-7-15(2)20(14)23-21(26)19(13-22)25-24-18-11-10-16-8-3-4-9-17(16)12-18/h3-12,24H,1-2H3,(H,23,26) |
| InChIKey | OYAFPWTXYVNXEG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|