C22H30N4O3S2 — CID 4845546
1-[5-[(2,4-dimethylphenyl)sulfamoyl]-2-methylphenyl]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 4845546) has the molecular formula C22H30N4O3S2 and a molecular weight of 462.64 g/mol. Its IUPAC name is 1-[5-[(2,4-dimethylphenyl)sulfamoyl]-2-methylphenyl]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[5-[(2,4-dimethylphenyl)sulfamoyl]-2-methylphenyl]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 4845546 |
| Molecular Formula | C22H30N4O3S2 |
| Molecular Weight | 462.64 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 1-[5-[(2,4-dimethylphenyl)sulfamoyl]-2-methylphenyl]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(C)c(NC(=S)NCCN3CCOCC3)c2)c(C)c1 |
| InChI | InChI=1S/C22H30N4O3S2/c1-16-4-7-20(18(3)14-16)25-31(27,28)19-6-5-17(2)21(15-19)24-22(30)23-8-9-26-10-12-29-13-11-26/h4-7,14-15,25H,8-13H2,1-3H3,(H2,23,24,30) |
| InChIKey | UNRMXTVKKOQBMI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.64 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|