C17H28N4O2S2 — CID 4045019
3-[5-(dimethylsulfamoyl)-2-methylphenyl]-1-methyl-1-(1-methylpiperidin-4-yl)thiourea (PubChem CID 4045019) has the molecular formula C17H28N4O2S2 and a molecular weight of 384.57 g/mol. Its IUPAC name is 3-[5-(dimethylsulfamoyl)-2-methylphenyl]-1-methyl-1-(1-methylpiperidin-4-yl)thiourea.
| Compound Name | 3-[5-(dimethylsulfamoyl)-2-methylphenyl]-1-methyl-1-(1-methylpiperidin-4-yl)thiourea |
|---|---|
| PubChem CID | 4045019 |
| Molecular Formula | C17H28N4O2S2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 3-[5-(dimethylsulfamoyl)-2-methylphenyl]-1-methyl-1-(1-methylpiperidin-4-yl)thiourea |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C)cc1NC(=S)N(C)C1CCN(C)CC1 |
| InChI | InChI=1S/C17H28N4O2S2/c1-13-6-7-15(25(22,23)19(2)3)12-16(13)18-17(24)21(5)14-8-10-20(4)11-9-14/h6-7,12,14H,8-11H2,1-5H3,(H,18,24) |
| InChIKey | KYPLMUHGOJZOKW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|