C20H29FN2OS — CID 4846003
2-(2-fluorophenyl)sulfanyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]acetamide (PubChem CID 4846003) has the molecular formula C20H29FN2OS and a molecular weight of 364.53 g/mol. Its IUPAC name is 2-(2-fluorophenyl)sulfanyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]acetamide.
| Compound Name | 2-(2-fluorophenyl)sulfanyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]acetamide |
|---|---|
| PubChem CID | 4846003 |
| Molecular Formula | C20H29FN2OS |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 2-(2-fluorophenyl)sulfanyl-N-[(1-piperidin-1-ylcyclohexyl)methyl]acetamide |
| SMILES | O=C(CSc1ccccc1F)NCC1(N2CCCCC2)CCCCC1 |
| InChI | InChI=1S/C20H29FN2OS/c21-17-9-3-4-10-18(17)25-15-19(24)22-16-20(11-5-1-6-12-20)23-13-7-2-8-14-23/h3-4,9-10H,1-2,5-8,11-16H2,(H,22,24) |
| InChIKey | QVSKZKXWTUBLCH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |