C20H29FN2O2S — CID 52717503
4-(2-fluorophenoxy)-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]butanamide (PubChem CID 52717503) has the molecular formula C20H29FN2O2S and a molecular weight of 380.53 g/mol. Its IUPAC name is 4-(2-fluorophenoxy)-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]butanamide.
| Compound Name | 4-(2-fluorophenoxy)-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]butanamide |
|---|---|
| PubChem CID | 52717503 |
| Molecular Formula | C20H29FN2O2S |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | 4-(2-fluorophenoxy)-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]butanamide |
| SMILES | O=C(CCCOc1ccccc1F)NCC1(N2CCSCC2)CCCC1 |
| InChI | InChI=1S/C20H29FN2O2S/c21-17-6-1-2-7-18(17)25-13-5-8-19(24)22-16-20(9-3-4-10-20)23-11-14-26-15-12-23/h1-2,6-7H,3-5,8-16H2,(H,22,24) |
| InChIKey | OLXXXTLENAXEOT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|