C16H13N3O5S — CID 4847147
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(4-cyanophenoxy)acetate (PubChem CID 4847147) has the molecular formula C16H13N3O5S and a molecular weight of 359.36 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(4-cyanophenoxy)acetate.
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(4-cyanophenoxy)acetate |
|---|---|
| PubChem CID | 4847147 |
| Molecular Formula | C16H13N3O5S |
| Molecular Weight | 359.36 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 2-(4-cyanophenoxy)acetate |
| SMILES | N#Cc1ccc(OCC(=O)OCC(=O)Nc2sccc2C(N)=O)cc1 |
| InChI | InChI=1S/C16H13N3O5S/c17-7-10-1-3-11(4-2-10)23-9-14(21)24-8-13(20)19-16-12(15(18)22)5-6-25-16/h1-6H,8-9H2,(H2,18,22)(H,19,20) |
| InChIKey | FGHCVDDPCJZTBR-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 131.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.36 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |