C17H20N2O4S — CID 2093480
2-[4-(2-ethoxyphenoxy)butanoylamino]thiophene-3-carboxamide (PubChem CID 2093480) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is 2-[4-(2-ethoxyphenoxy)butanoylamino]thiophene-3-carboxamide.
| Compound Name | 2-[4-(2-ethoxyphenoxy)butanoylamino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 2093480 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-[4-(2-ethoxyphenoxy)butanoylamino]thiophene-3-carboxamide |
| SMILES | CCOc1ccccc1OCCCC(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C17H20N2O4S/c1-2-22-13-6-3-4-7-14(13)23-10-5-8-15(20)19-17-12(16(18)21)9-11-24-17/h3-4,6-7,9,11H,2,5,8,10H2,1H3,(H2,18,21)(H,19,20) |
| InChIKey | AKODWSDGFFOUMO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|