C19H19N3O6S — CID 4848977
ethyl 3-[[6-hydroxy-1-(2-methoxyethyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-1-benzofuran-2-carboxylate (PubChem CID 4848977) has the molecular formula C19H19N3O6S and a molecular weight of 417.44 g/mol. Its IUPAC name is ethyl 3-[[6-hydroxy-1-(2-methoxyethyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-[[6-hydroxy-1-(2-methoxyethyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 4848977 |
| Molecular Formula | C19H19N3O6S |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | ethyl 3-[[6-hydroxy-1-(2-methoxyethyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccccc2c1/N=C/c1c(O)n(CCOC)c(=S)[nH]c1=O |
| InChI | InChI=1S/C19H19N3O6S/c1-3-27-18(25)15-14(11-6-4-5-7-13(11)28-15)20-10-12-16(23)21-19(29)22(17(12)24)8-9-26-2/h4-7,10,24H,3,8-9H2,1-2H3,(H,21,23,29)/b20-10+ |
| InChIKey | YYDFIZLLGKZCMT-KEBDBYFISA-N |
| XLogP | 2.93 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|