C15H15ClN4O5S — CID 137266611
5-chloro-2-hydroxy-N-[(Z)-[6-hydroxy-1-(2-methoxyethyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]benzamide (PubChem CID 137266611) has the molecular formula C15H15ClN4O5S and a molecular weight of 398.83 g/mol. Its IUPAC name is 5-chloro-2-hydroxy-N-[(Z)-[6-hydroxy-1-(2-methoxyethyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]benzamide.
| Compound Name | 5-chloro-2-hydroxy-N-[(Z)-[6-hydroxy-1-(2-methoxyethyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 137266611 |
| Molecular Formula | C15H15ClN4O5S |
| Molecular Weight | 398.83 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 5-chloro-2-hydroxy-N-[(Z)-[6-hydroxy-1-(2-methoxyethyl)-4-oxo-2-sulfanylidenepyrimidin-5-yl]methylideneamino]benzamide |
| SMILES | COCCn1c(O)c(/C=N\NC(=O)c2cc(Cl)ccc2O)c(=O)[nH]c1=S |
| InChI | InChI=1S/C15H15ClN4O5S/c1-25-5-4-20-14(24)10(12(22)18-15(20)26)7-17-19-13(23)9-6-8(16)2-3-11(9)21/h2-3,6-7,21,24H,4-5H2,1H3,(H,19,23)(H,18,22,26)/b17-7- |
| InChIKey | QWJMAFCSICASKL-IDUWFGFVSA-N |
| XLogP | 1.38 |
| TPSA | 128.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.83 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|