C20H12F3N3O2S2 — CID 4849926
5-(1,3-benzothiazol-2-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]thiophene-2-carboxamide (PubChem CID 4849926) has the molecular formula C20H12F3N3O2S2 and a molecular weight of 447.46 g/mol. Its IUPAC name is 5-(1,3-benzothiazol-2-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]thiophene-2-carboxamide.
| Compound Name | 5-(1,3-benzothiazol-2-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 4849926 |
| Molecular Formula | C20H12F3N3O2S2 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | 5-(1,3-benzothiazol-2-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc(-c2nc3ccccc3s2)s1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H12F3N3O2S2/c21-10-5-6-12(18(23)17(10)22)25-16(27)9-24-19(28)14-7-8-15(29-14)20-26-11-3-1-2-4-13(11)30-20/h1-8H,9H2,(H,24,28)(H,25,27) |
| InChIKey | HUVMRLMCPHRKSU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|