C16H22ClNO4 — CID 48500260
N-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-(cyclopropylmethoxy)propanamide (PubChem CID 48500260) has the molecular formula C16H22ClNO4 and a molecular weight of 327.81 g/mol. Its IUPAC name is N-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-(cyclopropylmethoxy)propanamide.
| Compound Name | N-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-(cyclopropylmethoxy)propanamide |
|---|---|
| PubChem CID | 48500260 |
| Molecular Formula | C16H22ClNO4 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-(cyclopropylmethoxy)propanamide |
| SMILES | COCCOc1ccc(NC(=O)C(C)OCC2CC2)cc1Cl |
| InChI | InChI=1S/C16H22ClNO4/c1-11(22-10-12-3-4-12)16(19)18-13-5-6-15(14(17)9-13)21-8-7-20-2/h5-6,9,11-12H,3-4,7-8,10H2,1-2H3,(H,18,19) |
| InChIKey | PIDREVROORHDII-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|