C15H12BrClN2O4 — CID 4850936
[6-chloro-1-(2-hydroxyethyl)benzimidazol-2-yl]methyl 5-bromofuran-2-carboxylate (PubChem CID 4850936) has the molecular formula C15H12BrClN2O4 and a molecular weight of 399.63 g/mol. Its IUPAC name is [6-chloro-1-(2-hydroxyethyl)benzimidazol-2-yl]methyl 5-bromofuran-2-carboxylate.
| Compound Name | [6-chloro-1-(2-hydroxyethyl)benzimidazol-2-yl]methyl 5-bromofuran-2-carboxylate |
|---|---|
| PubChem CID | 4850936 |
| Molecular Formula | C15H12BrClN2O4 |
| Molecular Weight | 399.63 g/mol |
| Exact Mass | 397.97 |
| IUPAC Name | [6-chloro-1-(2-hydroxyethyl)benzimidazol-2-yl]methyl 5-bromofuran-2-carboxylate |
| SMILES | O=C(OCc1nc2ccc(Cl)cc2n1CCO)c1ccc(Br)o1 |
| InChI | InChI=1S/C15H12BrClN2O4/c16-13-4-3-12(23-13)15(21)22-8-14-18-10-2-1-9(17)7-11(10)19(14)5-6-20/h1-4,7,20H,5-6,8H2 |
| InChIKey | NAVKECNZIXSCFY-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.63 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |