C19H18ClN3O7 — CID 4829089
[6-chloro-1-(2-hydroxyethyl)benzimidazol-2-yl]methyl 4,5-dimethoxy-2-nitrobenzoate (PubChem CID 4829089) has the molecular formula C19H18ClN3O7 and a molecular weight of 435.82 g/mol. Its IUPAC name is [6-chloro-1-(2-hydroxyethyl)benzimidazol-2-yl]methyl 4,5-dimethoxy-2-nitrobenzoate.
| Compound Name | [6-chloro-1-(2-hydroxyethyl)benzimidazol-2-yl]methyl 4,5-dimethoxy-2-nitrobenzoate |
|---|---|
| PubChem CID | 4829089 |
| Molecular Formula | C19H18ClN3O7 |
| Molecular Weight | 435.82 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | [6-chloro-1-(2-hydroxyethyl)benzimidazol-2-yl]methyl 4,5-dimethoxy-2-nitrobenzoate |
| SMILES | COc1cc(C(=O)OCc2nc3ccc(Cl)cc3n2CCO)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C19H18ClN3O7/c1-28-16-8-12(14(23(26)27)9-17(16)29-2)19(25)30-10-18-21-13-4-3-11(20)7-15(13)22(18)5-6-24/h3-4,7-9,24H,5-6,10H2,1-2H3 |
| InChIKey | PADUYXHUDVFYCE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 125.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.82 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|