C14H22N4O — CID 4854182
N-(cycloheptylideneamino)-2-(3,5-dimethylpyrazol-1-yl)acetamide (PubChem CID 4854182) has the molecular formula C14H22N4O and a molecular weight of 262.36 g/mol. Its IUPAC name is N-(cycloheptylideneamino)-2-(3,5-dimethylpyrazol-1-yl)acetamide.
| Compound Name | N-(cycloheptylideneamino)-2-(3,5-dimethylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 4854182 |
| Molecular Formula | C14H22N4O |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | N-(cycloheptylideneamino)-2-(3,5-dimethylpyrazol-1-yl)acetamide |
| SMILES | Cc1cc(C)n(CC(=O)NN=C2CCCCCC2)n1 |
| InChI | InChI=1S/C14H22N4O/c1-11-9-12(2)18(17-11)10-14(19)16-15-13-7-5-3-4-6-8-13/h9H,3-8,10H2,1-2H3,(H,16,19) |
| InChIKey | DICXSNKPQQDILC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|