C17H29N5O — CID 4772295
3-(3,5-dimethylpyrazol-1-yl)-N-[(2,2,6,6-tetramethylpiperidin-4-ylidene)amino]propanamide (PubChem CID 4772295) has the molecular formula C17H29N5O and a molecular weight of 319.45 g/mol. Its IUPAC name is 3-(3,5-dimethylpyrazol-1-yl)-N-[(2,2,6,6-tetramethylpiperidin-4-ylidene)amino]propanamide.
| Compound Name | 3-(3,5-dimethylpyrazol-1-yl)-N-[(2,2,6,6-tetramethylpiperidin-4-ylidene)amino]propanamide |
|---|---|
| PubChem CID | 4772295 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | 3-(3,5-dimethylpyrazol-1-yl)-N-[(2,2,6,6-tetramethylpiperidin-4-ylidene)amino]propanamide |
| SMILES | Cc1cc(C)n(CCC(=O)NN=C2CC(C)(C)NC(C)(C)C2)n1 |
| InChI | InChI=1S/C17H29N5O/c1-12-9-13(2)22(20-12)8-7-15(23)19-18-14-10-16(3,4)21-17(5,6)11-14/h9,21H,7-8,10-11H2,1-6H3,(H,19,23) |
| InChIKey | IIMNOQRAWWLQJS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|