C19H20N4O — CID 5418862
3-(3,5-dimethylpyrazol-1-yl)-N-[(Z)-naphthalen-1-ylmethylideneamino]propanamide (PubChem CID 5418862) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is 3-(3,5-dimethylpyrazol-1-yl)-N-[(Z)-naphthalen-1-ylmethylideneamino]propanamide.
| Compound Name | 3-(3,5-dimethylpyrazol-1-yl)-N-[(Z)-naphthalen-1-ylmethylideneamino]propanamide |
|---|---|
| PubChem CID | 5418862 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 3-(3,5-dimethylpyrazol-1-yl)-N-[(Z)-naphthalen-1-ylmethylideneamino]propanamide |
| SMILES | Cc1cc(C)n(CCC(=O)N/N=C\c2cccc3ccccc23)n1 |
| InChI | InChI=1S/C19H20N4O/c1-14-12-15(2)23(22-14)11-10-19(24)21-20-13-17-8-5-7-16-6-3-4-9-18(16)17/h3-9,12-13H,10-11H2,1-2H3,(H,21,24)/b20-13- |
| InChIKey | FVCSEUIHABBYMQ-MOSHPQCFSA-N |
| XLogP | 3.19 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|