C15H18ClN3O3 — CID 48557349
5-chloro-4-[3-(3,4-dimethoxyphenyl)propylamino]-1H-pyridazin-6-one (PubChem CID 48557349) has the molecular formula C15H18ClN3O3 and a molecular weight of 323.78 g/mol. Its IUPAC name is 5-chloro-4-[3-(3,4-dimethoxyphenyl)propylamino]-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[3-(3,4-dimethoxyphenyl)propylamino]-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 48557349 |
| Molecular Formula | C15H18ClN3O3 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 5-chloro-4-[3-(3,4-dimethoxyphenyl)propylamino]-1H-pyridazin-6-one |
| SMILES | COc1ccc(CCCNc2cn[nH]c(=O)c2Cl)cc1OC |
| InChI | InChI=1S/C15H18ClN3O3/c1-21-12-6-5-10(8-13(12)22-2)4-3-7-17-11-9-18-19-15(20)14(11)16/h5-6,8-9H,3-4,7H2,1-2H3,(H2,17,19,20) |
| InChIKey | ULIBZNOSOGYFCO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|