C19H22N4O6 — CID 4855857
[2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate (PubChem CID 4855857) has the molecular formula C19H22N4O6 and a molecular weight of 402.41 g/mol. Its IUPAC name is [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate.
| Compound Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 4855857 |
| Molecular Formula | C19H22N4O6 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | [2-[2-(cyclopropylcarbamoyl)anilino]-2-oxoethyl] 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetate |
| SMILES | CC1(C)NC(=O)N(CC(=O)OCC(=O)Nc2ccccc2C(=O)NC2CC2)C1=O |
| InChI | InChI=1S/C19H22N4O6/c1-19(2)17(27)23(18(28)22-19)9-15(25)29-10-14(24)21-13-6-4-3-5-12(13)16(26)20-11-7-8-11/h3-6,11H,7-10H2,1-2H3,(H,20,26)(H,21,24)(H,22,28) |
| InChIKey | NVCGDPMETCTXSP-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|