C20H25F2N5O2S — CID 4859586
tert-butyl N-[1-[6-(2,4-difluorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]-3-methylbutyl]carbamate (PubChem CID 4859586) has the molecular formula C20H25F2N5O2S and a molecular weight of 437.52 g/mol. Its IUPAC name is tert-butyl N-[1-[6-(2,4-difluorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]-3-methylbutyl]carbamate.
| Compound Name | tert-butyl N-[1-[6-(2,4-difluorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 4859586 |
| Molecular Formula | C20H25F2N5O2S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | tert-butyl N-[1-[6-(2,4-difluorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]-3-methylbutyl]carbamate |
| SMILES | CC(C)CC(NC(=O)OC(C)(C)C)c1nnc2n1N=C(c1ccc(F)cc1F)CS2 |
| InChI | InChI=1S/C20H25F2N5O2S/c1-11(2)8-15(23-19(28)29-20(3,4)5)17-24-25-18-27(17)26-16(10-30-18)13-7-6-12(21)9-14(13)22/h6-7,9,11,15H,8,10H2,1-5H3,(H,23,28) |
| InChIKey | VDZCEGSEYATBLT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |