C20H26ClN5O2S — CID 4886045
tert-butyl N-[1-[6-(4-chloro-3-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]-2-methylpropyl]carbamate (PubChem CID 4886045) has the molecular formula C20H26ClN5O2S and a molecular weight of 435.98 g/mol. Its IUPAC name is tert-butyl N-[1-[6-(4-chloro-3-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[1-[6-(4-chloro-3-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 4886045 |
| Molecular Formula | C20H26ClN5O2S |
| Molecular Weight | 435.98 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | tert-butyl N-[1-[6-(4-chloro-3-methylphenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]-2-methylpropyl]carbamate |
| SMILES | Cc1cc(C2=Nn3c(nnc3C(NC(=O)OC(C)(C)C)C(C)C)SC2)ccc1Cl |
| InChI | InChI=1S/C20H26ClN5O2S/c1-11(2)16(22-19(27)28-20(4,5)6)17-23-24-18-26(17)25-15(10-29-18)13-7-8-14(21)12(3)9-13/h7-9,11,16H,10H2,1-6H3,(H,22,27) |
| InChIKey | PSXXZBLWZVSBGK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.98 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |