C16H17Cl2N5O2S — CID 4886835
tert-butyl N-[[6-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]methyl]carbamate (PubChem CID 4886835) has the molecular formula C16H17Cl2N5O2S and a molecular weight of 414.32 g/mol. Its IUPAC name is tert-butyl N-[[6-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[6-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 4886835 |
| Molecular Formula | C16H17Cl2N5O2S |
| Molecular Weight | 414.32 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | tert-butyl N-[[6-(2,4-dichlorophenyl)-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1nnc2n1N=C(c1ccc(Cl)cc1Cl)CS2 |
| InChI | InChI=1S/C16H17Cl2N5O2S/c1-16(2,3)25-15(24)19-7-13-20-21-14-23(13)22-12(8-26-14)10-5-4-9(17)6-11(10)18/h4-6H,7-8H2,1-3H3,(H,19,24) |
| InChIKey | HVLXZDRJFKJDGO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |