C15H22N4O5 — CID 4860884
2-[3-(dimethylamino)propylamino]-4-(3-nitroanilino)-4-oxobutanoic acid (PubChem CID 4860884) has the molecular formula C15H22N4O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propylamino]-4-(3-nitroanilino)-4-oxobutanoic acid.
| Compound Name | 2-[3-(dimethylamino)propylamino]-4-(3-nitroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 4860884 |
| Molecular Formula | C15H22N4O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 2-[3-(dimethylamino)propylamino]-4-(3-nitroanilino)-4-oxobutanoic acid |
| SMILES | CN(C)CCCNC(CC(=O)Nc1cccc([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C15H22N4O5/c1-18(2)8-4-7-16-13(15(21)22)10-14(20)17-11-5-3-6-12(9-11)19(23)24/h3,5-6,9,13,16H,4,7-8,10H2,1-2H3,(H,17,20)(H,21,22) |
| InChIKey | DSKLWVLQBRMYOB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|