C14H20N4O5 — CID 66491297
4-(4-amino-3-nitroanilino)-2-(butylamino)-4-oxobutanoic acid (PubChem CID 66491297) has the molecular formula C14H20N4O5 and a molecular weight of 324.34 g/mol. Its IUPAC name is 4-(4-amino-3-nitroanilino)-2-(butylamino)-4-oxobutanoic acid.
| Compound Name | 4-(4-amino-3-nitroanilino)-2-(butylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 66491297 |
| Molecular Formula | C14H20N4O5 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 4-(4-amino-3-nitroanilino)-2-(butylamino)-4-oxobutanoic acid |
| SMILES | CCCCNC(CC(=O)Nc1ccc(N)c([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C14H20N4O5/c1-2-3-6-16-11(14(20)21)8-13(19)17-9-4-5-10(15)12(7-9)18(22)23/h4-5,7,11,16H,2-3,6,8,15H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | XXWSXARIZOYRHT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 147.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|