C22H24N4O2 — CID 4862946
1-methyl-4-[(4-phenylmethoxyphenyl)methylideneamino]-N-propylpyrazole-5-carboxamide (PubChem CID 4862946) has the molecular formula C22H24N4O2 and a molecular weight of 376.46 g/mol. Its IUPAC name is 1-methyl-4-[(4-phenylmethoxyphenyl)methylideneamino]-N-propylpyrazole-5-carboxamide.
| Compound Name | 1-methyl-4-[(4-phenylmethoxyphenyl)methylideneamino]-N-propylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4862946 |
| Molecular Formula | C22H24N4O2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 1-methyl-4-[(4-phenylmethoxyphenyl)methylideneamino]-N-propylpyrazole-5-carboxamide |
| SMILES | CCCNC(=O)c1c(/N=C/c2ccc(OCc3ccccc3)cc2)cnn1C |
| InChI | InChI=1S/C22H24N4O2/c1-3-13-23-22(27)21-20(15-25-26(21)2)24-14-17-9-11-19(12-10-17)28-16-18-7-5-4-6-8-18/h4-12,14-15H,3,13,16H2,1-2H3,(H,23,27)/b24-14+ |
| InChIKey | JNWTVGIBHIRMJJ-ZVHZXABRSA-N |
| XLogP | 3.89 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|