C22H32N2O12 — CID 4863636
(2,4,5-triacetyloxy-1,6-dimorpholin-4-yl-1,6-dioxohexan-3-yl) acetate (PubChem CID 4863636) has the molecular formula C22H32N2O12 and a molecular weight of 516.50 g/mol. Its IUPAC name is (2,4,5-triacetyloxy-1,6-dimorpholin-4-yl-1,6-dioxohexan-3-yl) acetate.
| Compound Name | (2,4,5-triacetyloxy-1,6-dimorpholin-4-yl-1,6-dioxohexan-3-yl) acetate |
|---|---|
| PubChem CID | 4863636 |
| Molecular Formula | C22H32N2O12 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | (2,4,5-triacetyloxy-1,6-dimorpholin-4-yl-1,6-dioxohexan-3-yl) acetate |
| SMILES | CC(=O)OC(C(=O)N1CCOCC1)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C22H32N2O12/c1-13(25)33-17(19(35-15(3)27)21(29)23-5-9-31-10-6-23)18(34-14(2)26)20(36-16(4)28)22(30)24-7-11-32-12-8-24/h17-20H,5-12H2,1-4H3 |
| InChIKey | GPMNWAXIRMNNKT-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 164.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|