C25H34N2O3 — CID 48664800
5-(2,5-dimethylphenoxy)-N-[1-(4-morpholin-4-ylphenyl)ethyl]pentanamide (PubChem CID 48664800) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is 5-(2,5-dimethylphenoxy)-N-[1-(4-morpholin-4-ylphenyl)ethyl]pentanamide.
| Compound Name | 5-(2,5-dimethylphenoxy)-N-[1-(4-morpholin-4-ylphenyl)ethyl]pentanamide |
|---|---|
| PubChem CID | 48664800 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 5-(2,5-dimethylphenoxy)-N-[1-(4-morpholin-4-ylphenyl)ethyl]pentanamide |
| SMILES | Cc1ccc(C)c(OCCCCC(=O)NC(C)c2ccc(N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C25H34N2O3/c1-19-7-8-20(2)24(18-19)30-15-5-4-6-25(28)26-21(3)22-9-11-23(12-10-22)27-13-16-29-17-14-27/h7-12,18,21H,4-6,13-17H2,1-3H3,(H,26,28) |
| InChIKey | RYLYWTYZJASPFE-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|