C14H18N6O5 — CID 4866858
ethyl 1-methyl-3-[2-(5-methyl-3-nitropyrazol-1-yl)ethylcarbamoyl]pyrazole-5-carboxylate (PubChem CID 4866858) has the molecular formula C14H18N6O5 and a molecular weight of 350.34 g/mol. Its IUPAC name is ethyl 1-methyl-3-[2-(5-methyl-3-nitropyrazol-1-yl)ethylcarbamoyl]pyrazole-5-carboxylate.
| Compound Name | ethyl 1-methyl-3-[2-(5-methyl-3-nitropyrazol-1-yl)ethylcarbamoyl]pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 4866858 |
| Molecular Formula | C14H18N6O5 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | ethyl 1-methyl-3-[2-(5-methyl-3-nitropyrazol-1-yl)ethylcarbamoyl]pyrazole-5-carboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)NCCn2nc([N+](=O)[O-])cc2C)nn1C |
| InChI | InChI=1S/C14H18N6O5/c1-4-25-14(22)11-8-10(16-18(11)3)13(21)15-5-6-19-9(2)7-12(17-19)20(23)24/h7-8H,4-6H2,1-3H3,(H,15,21) |
| InChIKey | NOKIKJAFSUJKLH-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 134.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|