C23H31ClN4O3 — CID 4870487
7'-chloro-3'-ethyl-1,3-dipropylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione (PubChem CID 4870487) has the molecular formula C23H31ClN4O3 and a molecular weight of 446.98 g/mol. Its IUPAC name is 7'-chloro-3'-ethyl-1,3-dipropylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione.
| Compound Name | 7'-chloro-3'-ethyl-1,3-dipropylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 4870487 |
| Molecular Formula | C23H31ClN4O3 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 7'-chloro-3'-ethyl-1,3-dipropylspiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-pyrazino[1,2-a]quinoline]-2,4,6-trione |
| SMILES | CCCN1C(=O)N(CCC)C(=O)C2(Cc3c(Cl)cccc3N3CCN(CC)CC32)C1=O |
| InChI | InChI=1S/C23H31ClN4O3/c1-4-10-27-20(29)23(21(30)28(11-5-2)22(27)31)14-16-17(24)8-7-9-18(16)26-13-12-25(6-3)15-19(23)26/h7-9,19H,4-6,10-15H2,1-3H3 |
| InChIKey | KYWISIMLFZVJQW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|