C20H26N2OS — CID 4871382
4-butylsulfanyl-7,7-dimethyl-2-(3-methylphenyl)-5,8-dihydropyrano[4,3-d]pyrimidine (PubChem CID 4871382) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is 4-butylsulfanyl-7,7-dimethyl-2-(3-methylphenyl)-5,8-dihydropyrano[4,3-d]pyrimidine.
| Compound Name | 4-butylsulfanyl-7,7-dimethyl-2-(3-methylphenyl)-5,8-dihydropyrano[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 4871382 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 4-butylsulfanyl-7,7-dimethyl-2-(3-methylphenyl)-5,8-dihydropyrano[4,3-d]pyrimidine |
| SMILES | CCCCSc1nc(-c2cccc(C)c2)nc2c1COC(C)(C)C2 |
| InChI | InChI=1S/C20H26N2OS/c1-5-6-10-24-19-16-13-23-20(3,4)12-17(16)21-18(22-19)15-9-7-8-14(2)11-15/h7-9,11H,5-6,10,12-13H2,1-4H3 |
| InChIKey | KAENQPIGRXTWCB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|