C22H28N2O3S — CID 4905660
pentyl 2-[(7,7-dimethyl-2-phenyl-5,8-dihydropyrano[4,3-d]pyrimidin-4-yl)sulfanyl]acetate (PubChem CID 4905660) has the molecular formula C22H28N2O3S and a molecular weight of 400.54 g/mol. Its IUPAC name is pentyl 2-[(7,7-dimethyl-2-phenyl-5,8-dihydropyrano[4,3-d]pyrimidin-4-yl)sulfanyl]acetate.
| Compound Name | pentyl 2-[(7,7-dimethyl-2-phenyl-5,8-dihydropyrano[4,3-d]pyrimidin-4-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 4905660 |
| Molecular Formula | C22H28N2O3S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | pentyl 2-[(7,7-dimethyl-2-phenyl-5,8-dihydropyrano[4,3-d]pyrimidin-4-yl)sulfanyl]acetate |
| SMILES | CCCCCOC(=O)CSc1nc(-c2ccccc2)nc2c1COC(C)(C)C2 |
| InChI | InChI=1S/C22H28N2O3S/c1-4-5-9-12-26-19(25)15-28-21-17-14-27-22(2,3)13-18(17)23-20(24-21)16-10-7-6-8-11-16/h6-8,10-11H,4-5,9,12-15H2,1-3H3 |
| InChIKey | UIXWEUUINOBVNW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|