C20H24N6O3S2 — CID 2000410
pentyl 2-[(15,15-dimethyl-16-oxa-19-thia-2,4,5,7,8,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaen-3-yl)sulfanyl]acetate (PubChem CID 2000410) has the molecular formula C20H24N6O3S2 and a molecular weight of 460.59 g/mol. Its IUPAC name is pentyl 2-[(15,15-dimethyl-16-oxa-19-thia-2,4,5,7,8,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaen-3-yl)sulfanyl]acetate.
| Compound Name | pentyl 2-[(15,15-dimethyl-16-oxa-19-thia-2,4,5,7,8,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaen-3-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 2000410 |
| Molecular Formula | C20H24N6O3S2 |
| Molecular Weight | 460.59 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | pentyl 2-[(15,15-dimethyl-16-oxa-19-thia-2,4,5,7,8,10-hexazapentacyclo[10.7.0.02,6.07,11.013,18]nonadeca-1(12),3,5,8,10,13(18)-hexaen-3-yl)sulfanyl]acetate |
| SMILES | CCCCCOC(=O)CSc1nnc2n3ncnc3c3c4c(sc3n12)COC(C)(C)C4 |
| InChI | InChI=1S/C20H24N6O3S2/c1-4-5-6-7-28-14(27)10-30-19-24-23-18-25(19)17-15(16-21-11-22-26(16)18)12-8-20(2,3)29-9-13(12)31-17/h11H,4-10H2,1-3H3 |
| InChIKey | LDGMKSJIZRNQJT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 95.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.59 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|