C28H25Cl3N2O5 — CID 4872914
3-(4-butoxy-3-methoxyphenyl)-2-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 4872914) has the molecular formula C28H25Cl3N2O5 and a molecular weight of 575.88 g/mol. Its IUPAC name is 3-(4-butoxy-3-methoxyphenyl)-2-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 3-(4-butoxy-3-methoxyphenyl)-2-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 4872914 |
| Molecular Formula | C28H25Cl3N2O5 |
| Molecular Weight | 575.88 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | 3-(4-butoxy-3-methoxyphenyl)-2-(4-chlorophenyl)-5-(3,4-dichlorophenyl)-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | CCCCOc1ccc(C2C3C(=O)N(c4ccc(Cl)c(Cl)c4)C(=O)C3ON2c2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C28H25Cl3N2O5/c1-3-4-13-37-22-12-5-16(14-23(22)36-2)25-24-26(38-33(25)18-8-6-17(29)7-9-18)28(35)32(27(24)34)19-10-11-20(30)21(31)15-19/h5-12,14-15,24-26H,3-4,13H2,1-2H3 |
| InChIKey | VSSSKKMRBGOJKO-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.88 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|