C23H32N2O5 — CID 4876280
[2-(cyclohexylamino)-2-oxoethyl] 2-[3-(4-methoxyphenyl)prop-2-enoylamino]-3-methylbutanoate (PubChem CID 4876280) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 2-[3-(4-methoxyphenyl)prop-2-enoylamino]-3-methylbutanoate.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 2-[3-(4-methoxyphenyl)prop-2-enoylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 4876280 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 2-[3-(4-methoxyphenyl)prop-2-enoylamino]-3-methylbutanoate |
| SMILES | COc1ccc(C=CC(=O)NC(C(=O)OCC(=O)NC2CCCCC2)C(C)C)cc1 |
| InChI | InChI=1S/C23H32N2O5/c1-16(2)22(23(28)30-15-21(27)24-18-7-5-4-6-8-18)25-20(26)14-11-17-9-12-19(29-3)13-10-17/h9-14,16,18,22H,4-8,15H2,1-3H3,(H,24,27)(H,25,26) |
| InChIKey | HCMBODZXFZNKKK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|